C17H26ClN5S — CID 17158692
N-(cyclohexylmethyl)-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride (PubChem CID 17158692) has the molecular formula C17H26ClN5S and a molecular weight of 367.95 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride.
| Compound Name | N-(cyclohexylmethyl)-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17158692 |
| Molecular Formula | C17H26ClN5S |
| Molecular Weight | 367.95 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-(cyclohexylmethyl)-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride |
| SMILES | Cl.c1ccc(-n2nnnc2SCCCNCC2CCCCC2)cc1 |
| InChI | InChI=1S/C17H25N5S.ClH/c1-3-8-15(9-4-1)14-18-12-7-13-23-17-19-20-21-22(17)16-10-5-2-6-11-16;/h2,5-6,10-11,15,18H,1,3-4,7-9,12-14H2;1H |
| InChIKey | KADMITNNBXNFEL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.95 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|