C19H20ClN5S — CID 93073160
N-[(Z)-3-(4-chlorophenyl)prop-2-enyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine (PubChem CID 93073160) has the molecular formula C19H20ClN5S and a molecular weight of 385.92 g/mol. Its IUPAC name is N-[(Z)-3-(4-chlorophenyl)prop-2-enyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine.
| Compound Name | N-[(Z)-3-(4-chlorophenyl)prop-2-enyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 93073160 |
| Molecular Formula | C19H20ClN5S |
| Molecular Weight | 385.92 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-[(Z)-3-(4-chlorophenyl)prop-2-enyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
| SMILES | Clc1ccc(/C=C\CNCCCSc2nnnn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H20ClN5S/c20-17-11-9-16(10-12-17)6-4-13-21-14-5-15-26-19-22-23-24-25(19)18-7-2-1-3-8-18/h1-4,6-12,21H,5,13-15H2/b6-4- |
| InChIKey | NACITKBIKLAARE-XQRVVYSFSA-N |
| XLogP | 4.10 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.92 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|