C19H21Cl2N5S — CID 17333681
N-[(E)-3-(4-chlorophenyl)prop-2-enyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride (PubChem CID 17333681) has the molecular formula C19H21Cl2N5S and a molecular weight of 422.39 g/mol. Its IUPAC name is N-[(E)-3-(4-chlorophenyl)prop-2-enyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride.
| Compound Name | N-[(E)-3-(4-chlorophenyl)prop-2-enyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17333681 |
| Molecular Formula | C19H21Cl2N5S |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | N-[(E)-3-(4-chlorophenyl)prop-2-enyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride |
| SMILES | Cl.Clc1ccc(/C=C/CNCCCSc2nnnn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H20ClN5S.ClH/c20-17-11-9-16(10-12-17)6-4-13-21-14-5-15-26-19-22-23-24-25(19)18-7-2-1-3-8-18;/h1-4,6-12,21H,5,13-15H2;1H/b6-4+; |
| InChIKey | NHRDHPLGEOOHGV-CVDVRWGVSA-N |
| XLogP | 4.52 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|