C19H24ClN5O2S — CID 17123303
N-[(2,4-dimethoxyphenyl)methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride (PubChem CID 17123303) has the molecular formula C19H24ClN5O2S and a molecular weight of 421.95 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17123303 |
| Molecular Formula | C19H24ClN5O2S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride |
| SMILES | COc1ccc(CNCCCSc2nnnn2-c2ccccc2)c(OC)c1.Cl |
| InChI | InChI=1S/C19H23N5O2S.ClH/c1-25-17-10-9-15(18(13-17)26-2)14-20-11-6-12-27-19-21-22-23-24(19)16-7-4-3-5-8-16;/h3-5,7-10,13,20H,6,11-12,14H2,1-2H3;1H |
| InChIKey | AZAAQRXBNWBWCY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|