C19H20N4O3S — CID 2296263
1-(2,4-dimethoxyphenyl)-4-(1-phenyltetrazol-5-yl)sulfanylbutan-1-one (PubChem CID 2296263) has the molecular formula C19H20N4O3S and a molecular weight of 384.46 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-4-(1-phenyltetrazol-5-yl)sulfanylbutan-1-one.
| Compound Name | 1-(2,4-dimethoxyphenyl)-4-(1-phenyltetrazol-5-yl)sulfanylbutan-1-one |
|---|---|
| PubChem CID | 2296263 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-4-(1-phenyltetrazol-5-yl)sulfanylbutan-1-one |
| SMILES | COc1ccc(C(=O)CCCSc2nnnn2-c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C19H20N4O3S/c1-25-15-10-11-16(18(13-15)26-2)17(24)9-6-12-27-19-20-21-22-23(19)14-7-4-3-5-8-14/h3-5,7-8,10-11,13H,6,9,12H2,1-2H3 |
| InChIKey | BQPGVNJYQNUYBE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|