C21H22ClN7OS — CID 17213637
3-(1-phenyltetrazol-5-yl)sulfanyl-N-[(3-pyrimidin-2-yloxyphenyl)methyl]propan-1-amine;hydrochloride (PubChem CID 17213637) has the molecular formula C21H22ClN7OS and a molecular weight of 455.98 g/mol. Its IUPAC name is 3-(1-phenyltetrazol-5-yl)sulfanyl-N-[(3-pyrimidin-2-yloxyphenyl)methyl]propan-1-amine;hydrochloride.
| Compound Name | 3-(1-phenyltetrazol-5-yl)sulfanyl-N-[(3-pyrimidin-2-yloxyphenyl)methyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17213637 |
| Molecular Formula | C21H22ClN7OS |
| Molecular Weight | 455.98 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 3-(1-phenyltetrazol-5-yl)sulfanyl-N-[(3-pyrimidin-2-yloxyphenyl)methyl]propan-1-amine;hydrochloride |
| SMILES | Cl.c1ccc(-n2nnnc2SCCCNCc2cccc(Oc3ncccn3)c2)cc1 |
| InChI | InChI=1S/C21H21N7OS.ClH/c1-2-8-18(9-3-1)28-21(25-26-27-28)30-14-6-11-22-16-17-7-4-10-19(15-17)29-20-23-12-5-13-24-20;/h1-5,7-10,12-13,15,22H,6,11,14,16H2;1H |
| InChIKey | BGVKLHBNTWCXBO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.98 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|