C13H15FNO+ — CID 7425125
ethyl-[[5-(2-fluorophenyl)furan-2-yl]methyl]azanium (PubChem CID 7425125) has the molecular formula C13H15FNO+ and a molecular weight of 220.27 g/mol. Its IUPAC name is ethyl-[[5-(2-fluorophenyl)furan-2-yl]methyl]azanium.
| Compound Name | ethyl-[[5-(2-fluorophenyl)furan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 7425125 |
| Molecular Formula | C13H15FNO+ |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | ethyl-[[5-(2-fluorophenyl)furan-2-yl]methyl]azanium |
| SMILES | CC[NH2+]Cc1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C13H14FNO/c1-2-15-9-10-7-8-13(16-10)11-5-3-4-6-12(11)14/h3-8,15H,2,9H2,1H3/p+1 |
| InChIKey | WEDAANYVHHWIGX-UHFFFAOYSA-O |
| XLogP | 2.17 |
| TPSA | 29.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |