C18H13ClFNO3 — CID 17058553
2-chloro-4-[[5-(2-fluorophenyl)furan-2-yl]methylamino]benzoic acid (PubChem CID 17058553) has the molecular formula C18H13ClFNO3 and a molecular weight of 345.76 g/mol. Its IUPAC name is 2-chloro-4-[[5-(2-fluorophenyl)furan-2-yl]methylamino]benzoic acid.
| Compound Name | 2-chloro-4-[[5-(2-fluorophenyl)furan-2-yl]methylamino]benzoic acid |
|---|---|
| PubChem CID | 17058553 |
| Molecular Formula | C18H13ClFNO3 |
| Molecular Weight | 345.76 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 2-chloro-4-[[5-(2-fluorophenyl)furan-2-yl]methylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NCc2ccc(-c3ccccc3F)o2)cc1Cl |
| InChI | InChI=1S/C18H13ClFNO3/c19-15-9-11(5-7-13(15)18(22)23)21-10-12-6-8-17(24-12)14-3-1-2-4-16(14)20/h1-9,21H,10H2,(H,22,23) |
| InChIKey | KHIVWRCFHKWHJD-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.76 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |