C18H22FNO3 — CID 122129177
2-ethyl-2-[[[5-(2-fluorophenyl)furan-2-yl]methylamino]methyl]butanoic acid (PubChem CID 122129177) has the molecular formula C18H22FNO3 and a molecular weight of 319.38 g/mol. Its IUPAC name is 2-ethyl-2-[[[5-(2-fluorophenyl)furan-2-yl]methylamino]methyl]butanoic acid.
| Compound Name | 2-ethyl-2-[[[5-(2-fluorophenyl)furan-2-yl]methylamino]methyl]butanoic acid |
|---|---|
| PubChem CID | 122129177 |
| Molecular Formula | C18H22FNO3 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 2-ethyl-2-[[[5-(2-fluorophenyl)furan-2-yl]methylamino]methyl]butanoic acid |
| SMILES | CCC(CC)(CNCc1ccc(-c2ccccc2F)o1)C(=O)O |
| InChI | InChI=1S/C18H22FNO3/c1-3-18(4-2,17(21)22)12-20-11-13-9-10-16(23-13)14-7-5-6-8-15(14)19/h5-10,20H,3-4,11-12H2,1-2H3,(H,21,22) |
| InChIKey | YNHWJXCAROLHPO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |