C22H17Br2N3O — CID 135457231
2-[(benzhydrylamino)methyl]-6,8-dibromo-3H-quinazolin-4-one (PubChem CID 135457231) has the molecular formula C22H17Br2N3O and a molecular weight of 499.21 g/mol. Its IUPAC name is 2-[(benzhydrylamino)methyl]-6,8-dibromo-3H-quinazolin-4-one.
| Compound Name | 2-[(benzhydrylamino)methyl]-6,8-dibromo-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135457231 |
| Molecular Formula | C22H17Br2N3O |
| Molecular Weight | 499.21 g/mol |
| Exact Mass | 496.97 |
| IUPAC Name | 2-[(benzhydrylamino)methyl]-6,8-dibromo-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(CNC(c2ccccc2)c2ccccc2)nc2c(Br)cc(Br)cc12 |
| InChI | InChI=1S/C22H17Br2N3O/c23-16-11-17-21(18(24)12-16)26-19(27-22(17)28)13-25-20(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-12,20,25H,13H2,(H,26,27,28) |
| InChIKey | BOIJDWSZERUDEE-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.21 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |