C11H10Br2N4OS — CID 135729755
(6,8-dibromo-4-oxo-3H-quinazolin-2-yl)methyl N'-methylcarbamimidothioate (PubChem CID 135729755) has the molecular formula C11H10Br2N4OS and a molecular weight of 406.10 g/mol. Its IUPAC name is (6,8-dibromo-4-oxo-3H-quinazolin-2-yl)methyl N'-methylcarbamimidothioate.
| Compound Name | (6,8-dibromo-4-oxo-3H-quinazolin-2-yl)methyl N'-methylcarbamimidothioate |
|---|---|
| PubChem CID | 135729755 |
| Molecular Formula | C11H10Br2N4OS |
| Molecular Weight | 406.10 g/mol |
| Exact Mass | 403.89 |
| IUPAC Name | (6,8-dibromo-4-oxo-3H-quinazolin-2-yl)methyl N'-methylcarbamimidothioate |
| SMILES | C/N=C(\N)SCc1nc2c(Br)cc(Br)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C11H10Br2N4OS/c1-15-11(14)19-4-8-16-9-6(10(18)17-8)2-5(12)3-7(9)13/h2-3H,4H2,1H3,(H2,14,15)(H,16,17,18) |
| InChIKey | WFAMZZCHLZOOLY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 84.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.10 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|