C15H17NO7 — CID 70143308
[(5-ethoxy-1,3-benzoxazol-2-yl)-ethoxycarbonyloxymethyl] acetate (PubChem CID 70143308) has the molecular formula C15H17NO7 and a molecular weight of 323.30 g/mol. Its IUPAC name is [(5-ethoxy-1,3-benzoxazol-2-yl)-ethoxycarbonyloxymethyl] acetate.
| Compound Name | [(5-ethoxy-1,3-benzoxazol-2-yl)-ethoxycarbonyloxymethyl] acetate |
|---|---|
| PubChem CID | 70143308 |
| Molecular Formula | C15H17NO7 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | [(5-ethoxy-1,3-benzoxazol-2-yl)-ethoxycarbonyloxymethyl] acetate |
| SMILES | CCOC(=O)OC(OC(C)=O)c1nc2cc(OCC)ccc2o1 |
| InChI | InChI=1S/C15H17NO7/c1-4-19-10-6-7-12-11(8-10)16-13(22-12)14(21-9(3)17)23-15(18)20-5-2/h6-8,14H,4-5H2,1-3H3 |
| InChIKey | XBUCDXPLHJTYMX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 97.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|