C20H23NO4 — CID 121447444
4-[3-(2-cyclopentyloxy-3-pyridinyl)phenoxy]butanoic acid (PubChem CID 121447444) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is 4-[3-(2-cyclopentyloxy-3-pyridinyl)phenoxy]butanoic acid.
| Compound Name | 4-[3-(2-cyclopentyloxy-3-pyridinyl)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 121447444 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 4-[3-(2-cyclopentyloxy-3-pyridinyl)phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cccc(-c2cccnc2OC2CCCC2)c1 |
| InChI | InChI=1S/C20H23NO4/c22-19(23)11-5-13-24-17-9-3-6-15(14-17)18-10-4-12-21-20(18)25-16-7-1-2-8-16/h3-4,6,9-10,12,14,16H,1-2,5,7-8,11,13H2,(H,22,23) |
| InChIKey | ZEVGOBKHTJYHNG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|