C21H24F2N2O3 — CID 150786428
4-[[4-[2-(cyclobutylmethoxy)-3-pyridinyl]-2,6-difluorophenyl]methylamino]butanoic acid (PubChem CID 150786428) has the molecular formula C21H24F2N2O3 and a molecular weight of 390.43 g/mol. Its IUPAC name is 4-[[4-[2-(cyclobutylmethoxy)-3-pyridinyl]-2,6-difluorophenyl]methylamino]butanoic acid.
| Compound Name | 4-[[4-[2-(cyclobutylmethoxy)-3-pyridinyl]-2,6-difluorophenyl]methylamino]butanoic acid |
|---|---|
| PubChem CID | 150786428 |
| Molecular Formula | C21H24F2N2O3 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 4-[[4-[2-(cyclobutylmethoxy)-3-pyridinyl]-2,6-difluorophenyl]methylamino]butanoic acid |
| SMILES | O=C(O)CCCNCc1c(F)cc(-c2cccnc2OCC2CCC2)cc1F |
| InChI | InChI=1S/C21H24F2N2O3/c22-18-10-15(11-19(23)17(18)12-24-8-3-7-20(26)27)16-6-2-9-25-21(16)28-13-14-4-1-5-14/h2,6,9-11,14,24H,1,3-5,7-8,12-13H2,(H,26,27) |
| InChIKey | KCYHRVUJBQLCJO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|