C22H26F2N2O3 — CID 150234427
4-[[4-(2-cyclopentyloxy-5-methyl-3-pyridinyl)-2,6-difluorophenyl]methylamino]butanoic acid (PubChem CID 150234427) has the molecular formula C22H26F2N2O3 and a molecular weight of 404.46 g/mol. Its IUPAC name is 4-[[4-(2-cyclopentyloxy-5-methyl-3-pyridinyl)-2,6-difluorophenyl]methylamino]butanoic acid.
| Compound Name | 4-[[4-(2-cyclopentyloxy-5-methyl-3-pyridinyl)-2,6-difluorophenyl]methylamino]butanoic acid |
|---|---|
| PubChem CID | 150234427 |
| Molecular Formula | C22H26F2N2O3 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 4-[[4-(2-cyclopentyloxy-5-methyl-3-pyridinyl)-2,6-difluorophenyl]methylamino]butanoic acid |
| SMILES | Cc1cnc(OC2CCCC2)c(-c2cc(F)c(CNCCCC(=O)O)c(F)c2)c1 |
| InChI | InChI=1S/C22H26F2N2O3/c1-14-9-17(22(26-12-14)29-16-5-2-3-6-16)15-10-19(23)18(20(24)11-15)13-25-8-4-7-21(27)28/h9-12,16,25H,2-8,13H2,1H3,(H,27,28) |
| InChIKey | FWEQQVRJBYLRPZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|