C21H24F2N2O2S — CID 151112410
4-[[4-(2-cyclopentylsulfanyl-3-pyridinyl)-2,6-difluorophenyl]methylamino]butanoic acid (PubChem CID 151112410) has the molecular formula C21H24F2N2O2S and a molecular weight of 406.50 g/mol. Its IUPAC name is 4-[[4-(2-cyclopentylsulfanyl-3-pyridinyl)-2,6-difluorophenyl]methylamino]butanoic acid.
| Compound Name | 4-[[4-(2-cyclopentylsulfanyl-3-pyridinyl)-2,6-difluorophenyl]methylamino]butanoic acid |
|---|---|
| PubChem CID | 151112410 |
| Molecular Formula | C21H24F2N2O2S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 4-[[4-(2-cyclopentylsulfanyl-3-pyridinyl)-2,6-difluorophenyl]methylamino]butanoic acid |
| SMILES | O=C(O)CCCNCc1c(F)cc(-c2cccnc2SC2CCCC2)cc1F |
| InChI | InChI=1S/C21H24F2N2O2S/c22-18-11-14(12-19(23)17(18)13-24-9-4-8-20(26)27)16-7-3-10-25-21(16)28-15-5-1-2-6-15/h3,7,10-12,15,24H,1-2,4-6,8-9,13H2,(H,26,27) |
| InChIKey | MQKOJGVCMHLLKV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|