C20H23FN2O2S — CID 151592596
4-[[4-(2-cyclobutylsulfanyl-3-pyridinyl)-2-fluorophenyl]methylamino]butanoic acid (PubChem CID 151592596) has the molecular formula C20H23FN2O2S and a molecular weight of 374.48 g/mol. Its IUPAC name is 4-[[4-(2-cyclobutylsulfanyl-3-pyridinyl)-2-fluorophenyl]methylamino]butanoic acid.
| Compound Name | 4-[[4-(2-cyclobutylsulfanyl-3-pyridinyl)-2-fluorophenyl]methylamino]butanoic acid |
|---|---|
| PubChem CID | 151592596 |
| Molecular Formula | C20H23FN2O2S |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 4-[[4-(2-cyclobutylsulfanyl-3-pyridinyl)-2-fluorophenyl]methylamino]butanoic acid |
| SMILES | O=C(O)CCCNCc1ccc(-c2cccnc2SC2CCC2)cc1F |
| InChI | InChI=1S/C20H23FN2O2S/c21-18-12-14(8-9-15(18)13-22-10-3-7-19(24)25)17-6-2-11-23-20(17)26-16-4-1-5-16/h2,6,8-9,11-12,16,22H,1,3-5,7,10,13H2,(H,24,25) |
| InChIKey | QIUPAPTXXUPLQH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|