C20H21F2NO3 — CID 121447335
5-[4-(2-cyclobutyloxy-3-pyridinyl)-2,6-difluorophenyl]pentanoic acid (PubChem CID 121447335) has the molecular formula C20H21F2NO3 and a molecular weight of 361.39 g/mol. Its IUPAC name is 5-[4-(2-cyclobutyloxy-3-pyridinyl)-2,6-difluorophenyl]pentanoic acid.
| Compound Name | 5-[4-(2-cyclobutyloxy-3-pyridinyl)-2,6-difluorophenyl]pentanoic acid |
|---|---|
| PubChem CID | 121447335 |
| Molecular Formula | C20H21F2NO3 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 5-[4-(2-cyclobutyloxy-3-pyridinyl)-2,6-difluorophenyl]pentanoic acid |
| SMILES | O=C(O)CCCCc1c(F)cc(-c2cccnc2OC2CCC2)cc1F |
| InChI | InChI=1S/C20H21F2NO3/c21-17-11-13(12-18(22)16(17)7-1-2-9-19(24)25)15-8-4-10-23-20(15)26-14-5-3-6-14/h4,8,10-12,14H,1-3,5-7,9H2,(H,24,25) |
| InChIKey | CIQLTKNYEIPERZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|