C17H18F2N2O3 — CID 121447068
4-[2,6-difluoro-4-(2-methoxy-3-pyridinyl)-N-methylanilino]butanoic acid (PubChem CID 121447068) has the molecular formula C17H18F2N2O3 and a molecular weight of 336.34 g/mol. Its IUPAC name is 4-[2,6-difluoro-4-(2-methoxy-3-pyridinyl)-N-methylanilino]butanoic acid.
| Compound Name | 4-[2,6-difluoro-4-(2-methoxy-3-pyridinyl)-N-methylanilino]butanoic acid |
|---|---|
| PubChem CID | 121447068 |
| Molecular Formula | C17H18F2N2O3 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 4-[2,6-difluoro-4-(2-methoxy-3-pyridinyl)-N-methylanilino]butanoic acid |
| SMILES | COc1ncccc1-c1cc(F)c(N(C)CCCC(=O)O)c(F)c1 |
| InChI | InChI=1S/C17H18F2N2O3/c1-21(8-4-6-15(22)23)16-13(18)9-11(10-14(16)19)12-5-3-7-20-17(12)24-2/h3,5,7,9-10H,4,6,8H2,1-2H3,(H,22,23) |
| InChIKey | FQDRGMJEDSWXBT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |