C22H25F2NO3 — CID 121447306
5-[4-(2-cyclopentyloxy-3-pyridinyl)-2,6-difluorophenyl]hexanoic acid (PubChem CID 121447306) has the molecular formula C22H25F2NO3 and a molecular weight of 389.44 g/mol. Its IUPAC name is 5-[4-(2-cyclopentyloxy-3-pyridinyl)-2,6-difluorophenyl]hexanoic acid.
| Compound Name | 5-[4-(2-cyclopentyloxy-3-pyridinyl)-2,6-difluorophenyl]hexanoic acid |
|---|---|
| PubChem CID | 121447306 |
| Molecular Formula | C22H25F2NO3 |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 5-[4-(2-cyclopentyloxy-3-pyridinyl)-2,6-difluorophenyl]hexanoic acid |
| SMILES | CC(CCCC(=O)O)c1c(F)cc(-c2cccnc2OC2CCCC2)cc1F |
| InChI | InChI=1S/C22H25F2NO3/c1-14(6-4-10-20(26)27)21-18(23)12-15(13-19(21)24)17-9-5-11-25-22(17)28-16-7-2-3-8-16/h5,9,11-14,16H,2-4,6-8,10H2,1H3,(H,26,27) |
| InChIKey | UZYVNGWVKHZQIX-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |