C14H18FN3O4 — CID 122018323
3-[[3-[(3-fluoro-2-pyridinyl)oxy]piperidine-1-carbonyl]amino]propanoic acid (PubChem CID 122018323) has the molecular formula C14H18FN3O4 and a molecular weight of 311.31 g/mol. Its IUPAC name is 3-[[3-[(3-fluoro-2-pyridinyl)oxy]piperidine-1-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[3-[(3-fluoro-2-pyridinyl)oxy]piperidine-1-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122018323 |
| Molecular Formula | C14H18FN3O4 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 3-[[3-[(3-fluoro-2-pyridinyl)oxy]piperidine-1-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)N1CCCC(Oc2ncccc2F)C1 |
| InChI | InChI=1S/C14H18FN3O4/c15-11-4-1-6-16-13(11)22-10-3-2-8-18(9-10)14(21)17-7-5-12(19)20/h1,4,6,10H,2-3,5,7-9H2,(H,17,21)(H,19,20) |
| InChIKey | IYUXQOVIBOICFE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |