C14H22ClN5O2 — CID 117054833
N-(2-chloroethyl)-3-[3-(dimethylamino)pyrazin-2-yl]oxypiperidine-1-carboxamide (PubChem CID 117054833) has the molecular formula C14H22ClN5O2 and a molecular weight of 327.82 g/mol. Its IUPAC name is N-(2-chloroethyl)-3-[3-(dimethylamino)pyrazin-2-yl]oxypiperidine-1-carboxamide.
| Compound Name | N-(2-chloroethyl)-3-[3-(dimethylamino)pyrazin-2-yl]oxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 117054833 |
| Molecular Formula | C14H22ClN5O2 |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | N-(2-chloroethyl)-3-[3-(dimethylamino)pyrazin-2-yl]oxypiperidine-1-carboxamide |
| SMILES | CN(C)c1nccnc1OC1CCCN(C(=O)NCCCl)C1 |
| InChI | InChI=1S/C14H22ClN5O2/c1-19(2)12-13(17-8-7-16-12)22-11-4-3-9-20(10-11)14(21)18-6-5-15/h7-8,11H,3-6,9-10H2,1-2H3,(H,18,21) |
| InChIKey | AONRMISMMFQWOL-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|