C19H21NO3S — CID 141426986
2-[4-(2-cyclopentyloxy-3-pyridinyl)phenyl]sulfanylpropanoic acid (PubChem CID 141426986) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is 2-[4-(2-cyclopentyloxy-3-pyridinyl)phenyl]sulfanylpropanoic acid.
| Compound Name | 2-[4-(2-cyclopentyloxy-3-pyridinyl)phenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 141426986 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 2-[4-(2-cyclopentyloxy-3-pyridinyl)phenyl]sulfanylpropanoic acid |
| SMILES | CC(Sc1ccc(-c2cccnc2OC2CCCC2)cc1)C(=O)O |
| InChI | InChI=1S/C19H21NO3S/c1-13(19(21)22)24-16-10-8-14(9-11-16)17-7-4-12-20-18(17)23-15-5-2-3-6-15/h4,7-13,15H,2-3,5-6H2,1H3,(H,21,22) |
| InChIKey | CUOSWCLLTGWQRM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |