C24H27N3O4 — CID 51942830
(2R)-N-[(2-cyclopentyloxy-3-pyridinyl)methyl]-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide (PubChem CID 51942830) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is (2R)-N-[(2-cyclopentyloxy-3-pyridinyl)methyl]-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide.
| Compound Name | (2R)-N-[(2-cyclopentyloxy-3-pyridinyl)methyl]-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 51942830 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | (2R)-N-[(2-cyclopentyloxy-3-pyridinyl)methyl]-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide |
| SMILES | CC(C)[C@H](C(=O)NCc1cccnc1OC1CCCC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H27N3O4/c1-15(2)20(27-23(29)18-11-5-6-12-19(18)24(27)30)21(28)26-14-16-8-7-13-25-22(16)31-17-9-3-4-10-17/h5-8,11-13,15,17,20H,3-4,9-10,14H2,1-2H3,(H,26,28)/t20-/m1/s1 |
| InChIKey | UDGHIPXWFANIBV-HXUWFJFHSA-N |
| XLogP | 3.34 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|