C22H29N3O4 — CID 124742659
(2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(2-cyclopentyloxy-3-pyridinyl)methyl]propanamide (PubChem CID 124742659) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is (2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(2-cyclopentyloxy-3-pyridinyl)methyl]propanamide.
| Compound Name | (2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(2-cyclopentyloxy-3-pyridinyl)methyl]propanamide |
|---|---|
| PubChem CID | 124742659 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | (2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(2-cyclopentyloxy-3-pyridinyl)methyl]propanamide |
| SMILES | C[C@H](C(=O)NCc1cccnc1OC1CCCC1)N1C(=O)[C@@H]2CCCC[C@H]2C1=O |
| InChI | InChI=1S/C22H29N3O4/c1-14(25-21(27)17-10-4-5-11-18(17)22(25)28)19(26)24-13-15-7-6-12-23-20(15)29-16-8-2-3-9-16/h6-7,12,14,16-18H,2-5,8-11,13H2,1H3,(H,24,26)/t14-,17-,18-/m1/s1 |
| InChIKey | YEKOVALBLFTBDI-ZTFGCOKTSA-N |
| XLogP | 2.58 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|