C21H21FN4OS — CID 137396174
4-[[3-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]-2-pyridinyl]oxy]cyclohexane-1-thiol (PubChem CID 137396174) has the molecular formula C21H21FN4OS and a molecular weight of 396.49 g/mol. Its IUPAC name is 4-[[3-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]-2-pyridinyl]oxy]cyclohexane-1-thiol.
| Compound Name | 4-[[3-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]-2-pyridinyl]oxy]cyclohexane-1-thiol |
|---|---|
| PubChem CID | 137396174 |
| Molecular Formula | C21H21FN4OS |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 4-[[3-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]-2-pyridinyl]oxy]cyclohexane-1-thiol |
| SMILES | Nc1ncc(-c2ccc(-c3cccnc3OC3CCC(S)CC3)cc2F)cn1 |
| InChI | InChI=1S/C21H21FN4OS/c22-19-10-13(3-8-17(19)14-11-25-21(23)26-12-14)18-2-1-9-24-20(18)27-15-4-6-16(28)7-5-15/h1-3,8-12,15-16,28H,4-7H2,(H2,23,25,26) |
| InChIKey | KKQWCWMPJGDADS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|