C19H16FN3O2 — CID 123818234
1-[2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]phenoxy]propan-2-one (PubChem CID 123818234) has the molecular formula C19H16FN3O2 and a molecular weight of 337.35 g/mol. Its IUPAC name is 1-[2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]phenoxy]propan-2-one.
| Compound Name | 1-[2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]phenoxy]propan-2-one |
|---|---|
| PubChem CID | 123818234 |
| Molecular Formula | C19H16FN3O2 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 1-[2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]phenoxy]propan-2-one |
| SMILES | CC(=O)COc1ccccc1-c1ccc(-c2cnc(N)nc2)c(F)c1 |
| InChI | InChI=1S/C19H16FN3O2/c1-12(24)11-25-18-5-3-2-4-16(18)13-6-7-15(17(20)8-13)14-9-22-19(21)23-10-14/h2-10H,11H2,1H3,(H2,21,22,23) |
| InChIKey | LELSGPYADIDQNZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |