C20H18FN5O2S — CID 138711629
2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]-N-(2-oxopyrrolidin-3-yl)benzenesulfinamide (PubChem CID 138711629) has the molecular formula C20H18FN5O2S and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]-N-(2-oxopyrrolidin-3-yl)benzenesulfinamide.
| Compound Name | 2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]-N-(2-oxopyrrolidin-3-yl)benzenesulfinamide |
|---|---|
| PubChem CID | 138711629 |
| Molecular Formula | C20H18FN5O2S |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]-N-(2-oxopyrrolidin-3-yl)benzenesulfinamide |
| SMILES | Nc1ncc(-c2ccc(-c3ccccc3S(=O)NC3CCNC3=O)cc2F)cn1 |
| InChI | InChI=1S/C20H18FN5O2S/c21-16-9-12(5-6-14(16)13-10-24-20(22)25-11-13)15-3-1-2-4-18(15)29(28)26-17-7-8-23-19(17)27/h1-6,9-11,17,26H,7-8H2,(H,23,27)(H2,22,24,25) |
| InChIKey | YOPCRYVAWNJTOK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |