C18H18FN5OS — CID 138711929
N-(2-aminoethyl)-2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]benzenesulfinamide (PubChem CID 138711929) has the molecular formula C18H18FN5OS and a molecular weight of 371.44 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]benzenesulfinamide.
| Compound Name | N-(2-aminoethyl)-2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]benzenesulfinamide |
|---|---|
| PubChem CID | 138711929 |
| Molecular Formula | C18H18FN5OS |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | N-(2-aminoethyl)-2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]benzenesulfinamide |
| SMILES | NCCNS(=O)c1ccccc1-c1ccc(-c2cnc(N)cn2)c(F)c1 |
| InChI | InChI=1S/C18H18FN5OS/c19-15-9-12(5-6-14(15)16-10-23-18(21)11-22-16)13-3-1-2-4-17(13)26(25)24-8-7-20/h1-6,9-11,24H,7-8,20H2,(H2,21,23) |
| InChIKey | PHTTUSQOPYCKBT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |