C20H19FN4OS2 — CID 137395844
5-[2-fluoro-4-(2-thiomorpholin-4-ylsulfinylphenyl)phenyl]pyrazin-2-amine (PubChem CID 137395844) has the molecular formula C20H19FN4OS2 and a molecular weight of 414.53 g/mol. Its IUPAC name is 5-[2-fluoro-4-(2-thiomorpholin-4-ylsulfinylphenyl)phenyl]pyrazin-2-amine.
| Compound Name | 5-[2-fluoro-4-(2-thiomorpholin-4-ylsulfinylphenyl)phenyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 137395844 |
| Molecular Formula | C20H19FN4OS2 |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 5-[2-fluoro-4-(2-thiomorpholin-4-ylsulfinylphenyl)phenyl]pyrazin-2-amine |
| SMILES | Nc1cnc(-c2ccc(-c3ccccc3S(=O)N3CCSCC3)cc2F)cn1 |
| InChI | InChI=1S/C20H19FN4OS2/c21-17-11-14(5-6-16(17)18-12-24-20(22)13-23-18)15-3-1-2-4-19(15)28(26)25-7-9-27-10-8-25/h1-6,11-13H,7-10H2,(H2,22,24) |
| InChIKey | OQQWNEAYTXNMDG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |