C20H19FN4OS — CID 137395622
5-[2-fluoro-4-(2-pyrrolidin-1-ylsulfinylphenyl)phenyl]pyrazin-2-amine (PubChem CID 137395622) has the molecular formula C20H19FN4OS and a molecular weight of 382.46 g/mol. Its IUPAC name is 5-[2-fluoro-4-(2-pyrrolidin-1-ylsulfinylphenyl)phenyl]pyrazin-2-amine.
| Compound Name | 5-[2-fluoro-4-(2-pyrrolidin-1-ylsulfinylphenyl)phenyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 137395622 |
| Molecular Formula | C20H19FN4OS |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 5-[2-fluoro-4-(2-pyrrolidin-1-ylsulfinylphenyl)phenyl]pyrazin-2-amine |
| SMILES | Nc1cnc(-c2ccc(-c3ccccc3S(=O)N3CCCC3)cc2F)cn1 |
| InChI | InChI=1S/C20H19FN4OS/c21-17-11-14(7-8-16(17)18-12-24-20(22)13-23-18)15-5-1-2-6-19(15)27(26)25-9-3-4-10-25/h1-2,5-8,11-13H,3-4,9-10H2,(H2,22,24) |
| InChIKey | VJLYTZZDBWSFEE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |