C21H16FN5OS — CID 137396074
5-[2-fluoro-4-[2-(pyrimidin-2-ylsulfinylmethyl)phenyl]phenyl]pyrazin-2-amine (PubChem CID 137396074) has the molecular formula C21H16FN5OS and a molecular weight of 405.46 g/mol. Its IUPAC name is 5-[2-fluoro-4-[2-(pyrimidin-2-ylsulfinylmethyl)phenyl]phenyl]pyrazin-2-amine.
| Compound Name | 5-[2-fluoro-4-[2-(pyrimidin-2-ylsulfinylmethyl)phenyl]phenyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 137396074 |
| Molecular Formula | C21H16FN5OS |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 5-[2-fluoro-4-[2-(pyrimidin-2-ylsulfinylmethyl)phenyl]phenyl]pyrazin-2-amine |
| SMILES | Nc1cnc(-c2ccc(-c3ccccc3CS(=O)c3ncccn3)cc2F)cn1 |
| InChI | InChI=1S/C21H16FN5OS/c22-18-10-14(6-7-17(18)19-11-27-20(23)12-26-19)16-5-2-1-4-15(16)13-29(28)21-24-8-3-9-25-21/h1-12H,13H2,(H2,23,27) |
| InChIKey | RWOILYIVKMOWDC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |