C20H21ClFN3S — CID 90312683
5-[2-fluoro-4-[2-(propan-2-ylsulfanylmethyl)phenyl]phenyl]pyrazin-2-amine;hydrochloride (PubChem CID 90312683) has the molecular formula C20H21ClFN3S and a molecular weight of 389.93 g/mol. Its IUPAC name is 5-[2-fluoro-4-[2-(propan-2-ylsulfanylmethyl)phenyl]phenyl]pyrazin-2-amine;hydrochloride.
| Compound Name | 5-[2-fluoro-4-[2-(propan-2-ylsulfanylmethyl)phenyl]phenyl]pyrazin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 90312683 |
| Molecular Formula | C20H21ClFN3S |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 5-[2-fluoro-4-[2-(propan-2-ylsulfanylmethyl)phenyl]phenyl]pyrazin-2-amine;hydrochloride |
| SMILES | CC(C)SCc1ccccc1-c1ccc(-c2cnc(N)cn2)c(F)c1.Cl |
| InChI | InChI=1S/C20H20FN3S.ClH/c1-13(2)25-12-15-5-3-4-6-16(15)14-7-8-17(18(21)9-14)19-10-24-20(22)11-23-19;/h3-11,13H,12H2,1-2H3,(H2,22,24);1H |
| InChIKey | GYZLCJVCYAKIFF-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |