C22H25FN4OS — CID 137395916
N-[2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]phenyl]hexane-1-sulfinamide (PubChem CID 137395916) has the molecular formula C22H25FN4OS and a molecular weight of 412.53 g/mol. Its IUPAC name is N-[2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]phenyl]hexane-1-sulfinamide.
| Compound Name | N-[2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]phenyl]hexane-1-sulfinamide |
|---|---|
| PubChem CID | 137395916 |
| Molecular Formula | C22H25FN4OS |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | N-[2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]phenyl]hexane-1-sulfinamide |
| SMILES | CCCCCCS(=O)Nc1ccccc1-c1ccc(-c2cnc(N)cn2)c(F)c1 |
| InChI | InChI=1S/C22H25FN4OS/c1-2-3-4-7-12-29(28)27-20-9-6-5-8-17(20)16-10-11-18(19(23)13-16)21-14-26-22(24)15-25-21/h5-6,8-11,13-15,27H,2-4,7,12H2,1H3,(H2,24,26) |
| InChIKey | WOEXYZNTUXCTFQ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|