C25H30FN5O2S — CID 138711534
N-[5-[[2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]phenyl]sulfinylamino]hexyl]-N-ethylformamide (PubChem CID 138711534) has the molecular formula C25H30FN5O2S and a molecular weight of 483.61 g/mol. Its IUPAC name is N-[5-[[2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]phenyl]sulfinylamino]hexyl]-N-ethylformamide.
| Compound Name | N-[5-[[2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]phenyl]sulfinylamino]hexyl]-N-ethylformamide |
|---|---|
| PubChem CID | 138711534 |
| Molecular Formula | C25H30FN5O2S |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | N-[5-[[2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]phenyl]sulfinylamino]hexyl]-N-ethylformamide |
| SMILES | CCN(C=O)CCCCC(C)NS(=O)c1ccccc1-c1ccc(-c2cnc(N)cn2)c(F)c1 |
| InChI | InChI=1S/C25H30FN5O2S/c1-3-31(17-32)13-7-6-8-18(2)30-34(33)24-10-5-4-9-20(24)19-11-12-21(22(26)14-19)23-15-29-25(27)16-28-23/h4-5,9-12,14-18,30H,3,6-8,13H2,1-2H3,(H2,27,29) |
| InChIKey | MGRQWWZHLCJGFY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|