C20H15FN6S — CID 90313818
6-[2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]phenyl]sulfanylpyrimidin-4-amine (PubChem CID 90313818) has the molecular formula C20H15FN6S and a molecular weight of 390.45 g/mol. Its IUPAC name is 6-[2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]phenyl]sulfanylpyrimidin-4-amine.
| Compound Name | 6-[2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]phenyl]sulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 90313818 |
| Molecular Formula | C20H15FN6S |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 6-[2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]phenyl]sulfanylpyrimidin-4-amine |
| SMILES | Nc1cnc(-c2ccc(-c3ccccc3Sc3cc(N)ncn3)cc2F)cn1 |
| InChI | InChI=1S/C20H15FN6S/c21-15-7-12(5-6-14(15)16-9-25-19(23)10-24-16)13-3-1-2-4-17(13)28-20-8-18(22)26-11-27-20/h1-11H,(H2,23,25)(H2,22,26,27) |
| InChIKey | JEYXQRTYKSTOJM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |