C20H20ClFN4O3S — CID 90315188
5-[2-fluoro-4-[2-(oxan-4-ylsulfonyl)-3-pyridinyl]phenyl]pyrazin-2-amine;hydrochloride (PubChem CID 90315188) has the molecular formula C20H20ClFN4O3S and a molecular weight of 450.92 g/mol. Its IUPAC name is 5-[2-fluoro-4-[2-(oxan-4-ylsulfonyl)-3-pyridinyl]phenyl]pyrazin-2-amine;hydrochloride.
| Compound Name | 5-[2-fluoro-4-[2-(oxan-4-ylsulfonyl)-3-pyridinyl]phenyl]pyrazin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 90315188 |
| Molecular Formula | C20H20ClFN4O3S |
| Molecular Weight | 450.92 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 5-[2-fluoro-4-[2-(oxan-4-ylsulfonyl)-3-pyridinyl]phenyl]pyrazin-2-amine;hydrochloride |
| SMILES | Cl.Nc1cnc(-c2ccc(-c3cccnc3S(=O)(=O)C3CCOCC3)cc2F)cn1 |
| InChI | InChI=1S/C20H19FN4O3S.ClH/c21-17-10-13(3-4-16(17)18-11-25-19(22)12-24-18)15-2-1-7-23-20(15)29(26,27)14-5-8-28-9-6-14;/h1-4,7,10-12,14H,5-6,8-9H2,(H2,22,25);1H |
| InChIKey | JZCQGBZAYBBURL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.92 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |