C21H22ClFN4O2S — CID 90313745
5-[4-(2-cyclohexylsulfonyl-3-pyridinyl)-2-fluorophenyl]pyrazin-2-amine;hydrochloride (PubChem CID 90313745) has the molecular formula C21H22ClFN4O2S and a molecular weight of 448.95 g/mol. Its IUPAC name is 5-[4-(2-cyclohexylsulfonyl-3-pyridinyl)-2-fluorophenyl]pyrazin-2-amine;hydrochloride.
| Compound Name | 5-[4-(2-cyclohexylsulfonyl-3-pyridinyl)-2-fluorophenyl]pyrazin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 90313745 |
| Molecular Formula | C21H22ClFN4O2S |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 5-[4-(2-cyclohexylsulfonyl-3-pyridinyl)-2-fluorophenyl]pyrazin-2-amine;hydrochloride |
| SMILES | Cl.Nc1cnc(-c2ccc(-c3cccnc3S(=O)(=O)C3CCCCC3)cc2F)cn1 |
| InChI | InChI=1S/C21H21FN4O2S.ClH/c22-18-11-14(8-9-17(18)19-12-26-20(23)13-25-19)16-7-4-10-24-21(16)29(27,28)15-5-2-1-3-6-15;/h4,7-13,15H,1-3,5-6H2,(H2,23,26);1H |
| InChIKey | OYMSOHMNSUIALV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |