C23H24FN5O3S2 — CID 123481480
2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]-N-[(2-oxoazepan-3-yl)-sulfanylmethyl]benzenesulfonamide (PubChem CID 123481480) has the molecular formula C23H24FN5O3S2 and a molecular weight of 501.61 g/mol. Its IUPAC name is 2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]-N-[(2-oxoazepan-3-yl)-sulfanylmethyl]benzenesulfonamide.
| Compound Name | 2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]-N-[(2-oxoazepan-3-yl)-sulfanylmethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 123481480 |
| Molecular Formula | C23H24FN5O3S2 |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | 2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]-N-[(2-oxoazepan-3-yl)-sulfanylmethyl]benzenesulfonamide |
| SMILES | Nc1cnc(-c2ccc(-c3ccccc3S(=O)(=O)NC(S)C3CCCCNC3=O)cc2F)cn1 |
| InChI | InChI=1S/C23H24FN5O3S2/c24-18-11-14(8-9-16(18)19-12-28-21(25)13-27-19)15-5-1-2-7-20(15)34(31,32)29-23(33)17-6-3-4-10-26-22(17)30/h1-2,5,7-9,11-13,17,23,29,33H,3-4,6,10H2,(H2,25,28)(H,26,30) |
| InChIKey | WFALKYLKBYQWDL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|