C21H22FN5O2S — CID 138712041
5-[2-fluoro-4-[2-(2-morpholin-4-ylethylsulfinyl)-3-pyridinyl]phenyl]pyrazin-2-amine (PubChem CID 138712041) has the molecular formula C21H22FN5O2S and a molecular weight of 427.51 g/mol. Its IUPAC name is 5-[2-fluoro-4-[2-(2-morpholin-4-ylethylsulfinyl)-3-pyridinyl]phenyl]pyrazin-2-amine.
| Compound Name | 5-[2-fluoro-4-[2-(2-morpholin-4-ylethylsulfinyl)-3-pyridinyl]phenyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 138712041 |
| Molecular Formula | C21H22FN5O2S |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 5-[2-fluoro-4-[2-(2-morpholin-4-ylethylsulfinyl)-3-pyridinyl]phenyl]pyrazin-2-amine |
| SMILES | Nc1cnc(-c2ccc(-c3cccnc3S(=O)CCN3CCOCC3)cc2F)cn1 |
| InChI | InChI=1S/C21H22FN5O2S/c22-18-12-15(3-4-17(18)19-13-26-20(23)14-25-19)16-2-1-5-24-21(16)30(28)11-8-27-6-9-29-10-7-27/h1-5,12-14H,6-11H2,(H2,23,26) |
| InChIKey | CBODGLKDOXFGLV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 94.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |