C20H15FN6OS — CID 138712024
6-[2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]phenyl]sulfinylpyrimidin-4-amine (PubChem CID 138712024) has the molecular formula C20H15FN6OS and a molecular weight of 406.45 g/mol. Its IUPAC name is 6-[2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]phenyl]sulfinylpyrimidin-4-amine.
| Compound Name | 6-[2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]phenyl]sulfinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 138712024 |
| Molecular Formula | C20H15FN6OS |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 6-[2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]phenyl]sulfinylpyrimidin-4-amine |
| SMILES | Nc1cc(S(=O)c2ccccc2-c2ccc(-c3cnc(N)nc3)c(F)c2)ncn1 |
| InChI | InChI=1S/C20H15FN6OS/c21-16-7-12(5-6-14(16)13-9-24-20(23)25-10-13)15-3-1-2-4-17(15)29(28)19-8-18(22)26-11-27-19/h1-11H,(H2,22,26,27)(H2,23,24,25) |
| InChIKey | OUBHPTOAWXNWDG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 120.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |