C21H19FN4O — CID 123963220
[2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]phenyl]-pyrrolidin-1-ylmethanone (PubChem CID 123963220) has the molecular formula C21H19FN4O and a molecular weight of 362.41 g/mol. Its IUPAC name is [2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]phenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]phenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 123963220 |
| Molecular Formula | C21H19FN4O |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | [2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]phenyl]-pyrrolidin-1-ylmethanone |
| SMILES | Nc1ncc(-c2ccc(-c3ccccc3C(=O)N3CCCC3)cc2F)cn1 |
| InChI | InChI=1S/C21H19FN4O/c22-19-11-14(7-8-17(19)15-12-24-21(23)25-13-15)16-5-1-2-6-18(16)20(27)26-9-3-4-10-26/h1-2,5-8,11-13H,3-4,9-10H2,(H2,23,24,25) |
| InChIKey | PICZFFQHWXUPPL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |