C21H17AsFN3O2 — CID 90319937
CID 90319937 (PubChem CID 90319937) has the molecular formula C21H17AsFN3O2 and a molecular weight of 437.31 g/mol.
| Compound Name | CID 90319937 |
|---|---|
| PubChem CID | 90319937 |
| Molecular Formula | C21H17AsFN3O2 |
| Molecular Weight | 437.31 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | — |
| SMILES | O=C(c1ccccc1-c1ccc(-c2cnc([As])nc2)c(F)c1)N1CCOCC1 |
| InChI | InChI=1S/C21H17AsFN3O2/c22-21-24-12-15(13-25-21)17-6-5-14(11-19(17)23)16-3-1-2-4-18(16)20(27)26-7-9-28-10-8-26/h1-6,11-13H,7-10H2 |
| InChIKey | UEQJVMJPZIWOCY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|