C24H19F2NO4 — CID 45268223
[4-(2,4-difluorophenyl)-2-(morpholine-4-carbonyl)phenyl] benzoate (PubChem CID 45268223) has the molecular formula C24H19F2NO4 and a molecular weight of 423.42 g/mol. Its IUPAC name is [4-(2,4-difluorophenyl)-2-(morpholine-4-carbonyl)phenyl] benzoate.
| Compound Name | [4-(2,4-difluorophenyl)-2-(morpholine-4-carbonyl)phenyl] benzoate |
|---|---|
| PubChem CID | 45268223 |
| Molecular Formula | C24H19F2NO4 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | [4-(2,4-difluorophenyl)-2-(morpholine-4-carbonyl)phenyl] benzoate |
| SMILES | O=C(Oc1ccc(-c2ccc(F)cc2F)cc1C(=O)N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C24H19F2NO4/c25-18-7-8-19(21(26)15-18)17-6-9-22(31-24(29)16-4-2-1-3-5-16)20(14-17)23(28)27-10-12-30-13-11-27/h1-9,14-15H,10-13H2 |
| InChIKey | QIZQDVGDSFYTHP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|