C20H15FN6O2S — CID 90313696
2-[2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]phenyl]sulfonylpyrimidin-4-amine (PubChem CID 90313696) has the molecular formula C20H15FN6O2S and a molecular weight of 422.45 g/mol. Its IUPAC name is 2-[2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]phenyl]sulfonylpyrimidin-4-amine.
| Compound Name | 2-[2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]phenyl]sulfonylpyrimidin-4-amine |
|---|---|
| PubChem CID | 90313696 |
| Molecular Formula | C20H15FN6O2S |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 2-[2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]phenyl]sulfonylpyrimidin-4-amine |
| SMILES | Nc1ccnc(S(=O)(=O)c2ccccc2-c2ccc(-c3cnc(N)nc3)c(F)c2)n1 |
| InChI | InChI=1S/C20H15FN6O2S/c21-16-9-12(5-6-14(16)13-10-25-19(23)26-11-13)15-3-1-2-4-17(15)30(28,29)20-24-8-7-18(22)27-20/h1-11H,(H2,22,24,27)(H2,23,25,26) |
| InChIKey | WKEMRQUOEUFGNS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 137.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |