C19H19FN4O4S — CID 137396116
2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]-N-[(2S)-1,1-dihydroxypropan-2-yl]benzenesulfonamide (PubChem CID 137396116) has the molecular formula C19H19FN4O4S and a molecular weight of 418.45 g/mol. Its IUPAC name is 2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]-N-[(2S)-1,1-dihydroxypropan-2-yl]benzenesulfonamide.
| Compound Name | 2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]-N-[(2S)-1,1-dihydroxypropan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 137396116 |
| Molecular Formula | C19H19FN4O4S |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]-N-[(2S)-1,1-dihydroxypropan-2-yl]benzenesulfonamide |
| SMILES | C[C@H](NS(=O)(=O)c1ccccc1-c1ccc(-c2cnc(N)nc2)c(F)c1)C(O)O |
| InChI | InChI=1S/C19H19FN4O4S/c1-11(18(25)26)24-29(27,28)17-5-3-2-4-15(17)12-6-7-14(16(20)8-12)13-9-22-19(21)23-10-13/h2-11,18,24-26H,1H3,(H2,21,22,23)/t11-/m0/s1 |
| InChIKey | BPNPNZUZVUIXBY-NSHDSACASA-N |
| XLogP | 1.51 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|