C22H19FN4O2S — CID 144679080
2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]-N-[(3E)-hexa-1,3,5-trien-3-yl]benzenesulfonamide (PubChem CID 144679080) has the molecular formula C22H19FN4O2S and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]-N-[(3E)-hexa-1,3,5-trien-3-yl]benzenesulfonamide.
| Compound Name | 2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]-N-[(3E)-hexa-1,3,5-trien-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 144679080 |
| Molecular Formula | C22H19FN4O2S |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]-N-[(3E)-hexa-1,3,5-trien-3-yl]benzenesulfonamide |
| SMILES | C=C/C=C(\C=C)NS(=O)(=O)c1ccccc1-c1ccc(-c2cnc(N)nc2)c(F)c1 |
| InChI | InChI=1S/C22H19FN4O2S/c1-3-7-17(4-2)27-30(28,29)21-9-6-5-8-19(21)15-10-11-18(20(23)12-15)16-13-25-22(24)26-14-16/h3-14,27H,1-2H2,(H2,24,25,26)/b17-7+ |
| InChIKey | IEYBUFWMLRKCKH-REZTVBANSA-N |
| XLogP | 4.07 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|