C19H17FN4O4S — CID 123453367
2-[[2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]phenyl]sulfonylamino]propanoic acid (PubChem CID 123453367) has the molecular formula C19H17FN4O4S and a molecular weight of 416.43 g/mol. Its IUPAC name is 2-[[2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]phenyl]sulfonylamino]propanoic acid.
| Compound Name | 2-[[2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]phenyl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 123453367 |
| Molecular Formula | C19H17FN4O4S |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 2-[[2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]phenyl]sulfonylamino]propanoic acid |
| SMILES | CC(NS(=O)(=O)c1ccccc1-c1ccc(-c2cnc(N)nc2)c(F)c1)C(=O)O |
| InChI | InChI=1S/C19H17FN4O4S/c1-11(18(25)26)24-29(27,28)17-5-3-2-4-15(17)12-6-7-14(16(20)8-12)13-9-22-19(21)23-10-13/h2-11,24H,1H3,(H,25,26)(H2,21,22,23) |
| InChIKey | GNNKQYACGVXTGU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 135.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |