C20H22ClNO3S — CID 74222790
3-[3-chloro-4-[(2-cyclopentylsulfanyl-3-pyridinyl)methoxy]phenyl]propanoic acid (PubChem CID 74222790) has the molecular formula C20H22ClNO3S and a molecular weight of 391.92 g/mol. Its IUPAC name is 3-[3-chloro-4-[(2-cyclopentylsulfanyl-3-pyridinyl)methoxy]phenyl]propanoic acid.
| Compound Name | 3-[3-chloro-4-[(2-cyclopentylsulfanyl-3-pyridinyl)methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 74222790 |
| Molecular Formula | C20H22ClNO3S |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 3-[3-chloro-4-[(2-cyclopentylsulfanyl-3-pyridinyl)methoxy]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(OCc2cccnc2SC2CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C20H22ClNO3S/c21-17-12-14(8-10-19(23)24)7-9-18(17)25-13-15-4-3-11-22-20(15)26-16-5-1-2-6-16/h3-4,7,9,11-12,16H,1-2,5-6,8,10,13H2,(H,23,24) |
| InChIKey | OVUFYVFEVNRULK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |