C22H23N3O3 — CID 121162475
1-[4-(2-methylpyrimidin-4-yl)oxypiperidin-1-yl]-2-naphthalen-2-yloxyethanone (PubChem CID 121162475) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 1-[4-(2-methylpyrimidin-4-yl)oxypiperidin-1-yl]-2-naphthalen-2-yloxyethanone.
| Compound Name | 1-[4-(2-methylpyrimidin-4-yl)oxypiperidin-1-yl]-2-naphthalen-2-yloxyethanone |
|---|---|
| PubChem CID | 121162475 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 1-[4-(2-methylpyrimidin-4-yl)oxypiperidin-1-yl]-2-naphthalen-2-yloxyethanone |
| SMILES | Cc1nccc(OC2CCN(C(=O)COc3ccc4ccccc4c3)CC2)n1 |
| InChI | InChI=1S/C22H23N3O3/c1-16-23-11-8-21(24-16)28-19-9-12-25(13-10-19)22(26)15-27-20-7-6-17-4-2-3-5-18(17)14-20/h2-8,11,14,19H,9-10,12-13,15H2,1H3 |
| InChIKey | GHYIHPIXKVQWMN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |